C17H18Cl2N2O3S — CID 9071897
ethyl 2-[(4S)-4-(2,4-dichlorophenyl)-6-propan-2-yl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-2-oxoacetate (PubChem CID 9071897) has the molecular formula C17H18Cl2N2O3S and a molecular weight of 401.32 g/mol. Its IUPAC name is ethyl 2-[(4S)-4-(2,4-dichlorophenyl)-6-propan-2-yl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[(4S)-4-(2,4-dichlorophenyl)-6-propan-2-yl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 9071897 |
| Molecular Formula | C17H18Cl2N2O3S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | ethyl 2-[(4S)-4-(2,4-dichlorophenyl)-6-propan-2-yl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)C1=C(C(C)C)NC(=S)N[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H18Cl2N2O3S/c1-4-24-16(23)15(22)12-13(8(2)3)20-17(25)21-14(12)10-6-5-9(18)7-11(10)19/h5-8,14H,4H2,1-3H3,(H2,20,21,25)/t14-/m1/s1 |
| InChIKey | ORZGNDIKZPFRNB-CQSZACIVSA-N |
| XLogP | 3.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|