C16H18Cl2N2O5 — CID 110844161
ethyl 4-(3,5-dichloro-2,4-dihydroxyphenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110844161) has the molecular formula C16H18Cl2N2O5 and a molecular weight of 389.24 g/mol. Its IUPAC name is ethyl 4-(3,5-dichloro-2,4-dihydroxyphenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(3,5-dichloro-2,4-dihydroxyphenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110844161 |
| Molecular Formula | C16H18Cl2N2O5 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | ethyl 4-(3,5-dichloro-2,4-dihydroxyphenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C(C)C)NC(=O)NC1c1cc(Cl)c(O)c(Cl)c1O |
| InChI | InChI=1S/C16H18Cl2N2O5/c1-4-25-15(23)9-11(6(2)3)19-16(24)20-12(9)7-5-8(17)14(22)10(18)13(7)21/h5-6,12,21-22H,4H2,1-3H3,(H2,19,20,24) |
| InChIKey | OYHJEKQMVMAZKG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|