C16H18Br2N2O4 — CID 110846920
ethyl 4-(3,5-dibromo-2-hydroxyphenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110846920) has the molecular formula C16H18Br2N2O4 and a molecular weight of 462.14 g/mol. Its IUPAC name is ethyl 4-(3,5-dibromo-2-hydroxyphenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(3,5-dibromo-2-hydroxyphenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110846920 |
| Molecular Formula | C16H18Br2N2O4 |
| Molecular Weight | 462.14 g/mol |
| Exact Mass | 459.96 |
| IUPAC Name | ethyl 4-(3,5-dibromo-2-hydroxyphenyl)-2-oxo-6-propan-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C(C)C)NC(=O)NC1c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C16H18Br2N2O4/c1-4-24-15(22)11-12(7(2)3)19-16(23)20-13(11)9-5-8(17)6-10(18)14(9)21/h5-7,13,21H,4H2,1-3H3,(H2,19,20,23) |
| InChIKey | VUCIMHMRABBJBW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.14 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|