C25H18Br2O3 — CID 139260712
(3'R,5'R)-3',5'-bis(3-bromophenyl)spiro[1-benzofuran-3,4'-cyclohexane]-1',2-dione (PubChem CID 139260712) has the molecular formula C25H18Br2O3 and a molecular weight of 526.22 g/mol. Its IUPAC name is (3'R,5'R)-3',5'-bis(3-bromophenyl)spiro[1-benzofuran-3,4'-cyclohexane]-1',2-dione.
| Compound Name | (3'R,5'R)-3',5'-bis(3-bromophenyl)spiro[1-benzofuran-3,4'-cyclohexane]-1',2-dione |
|---|---|
| PubChem CID | 139260712 |
| Molecular Formula | C25H18Br2O3 |
| Molecular Weight | 526.22 g/mol |
| Exact Mass | 523.96 |
| IUPAC Name | (3'R,5'R)-3',5'-bis(3-bromophenyl)spiro[1-benzofuran-3,4'-cyclohexane]-1',2-dione |
| SMILES | O=C1C[C@H](c2cccc(Br)c2)C2(C(=O)Oc3ccccc32)[C@@H](c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C25H18Br2O3/c26-17-7-3-5-15(11-17)21-13-19(28)14-22(16-6-4-8-18(27)12-16)25(21)20-9-1-2-10-23(20)30-24(25)29/h1-12,21-22H,13-14H2/t21-,22-/m1/s1 |
| InChIKey | SNWSDTCWIUQLJM-FGZHOGPDSA-N |
| XLogP | 6.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.22 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|