C25H26O3 — CID 92982423
(7R,11R)-3,3-dimethyl-7,11-diphenylspiro[5.5]undecane-1,5,9-trione (PubChem CID 92982423) has the molecular formula C25H26O3 and a molecular weight of 374.48 g/mol. Its IUPAC name is (7R,11R)-3,3-dimethyl-7,11-diphenylspiro[5.5]undecane-1,5,9-trione.
| Compound Name | (7R,11R)-3,3-dimethyl-7,11-diphenylspiro[5.5]undecane-1,5,9-trione |
|---|---|
| PubChem CID | 92982423 |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (7R,11R)-3,3-dimethyl-7,11-diphenylspiro[5.5]undecane-1,5,9-trione |
| SMILES | CC1(C)CC(=O)C2(C(=O)C1)[C@@H](c1ccccc1)CC(=O)C[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C25H26O3/c1-24(2)15-22(27)25(23(28)16-24)20(17-9-5-3-6-10-17)13-19(26)14-21(25)18-11-7-4-8-12-18/h3-12,20-21H,13-16H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | XPPIZIALVLDCOF-NHCUHLMSSA-N |
| XLogP | 4.86 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|