About cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one
cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one (PubChem CID 101083109) has the molecular formula C20H20O
and a molecular weight of 276.38 g/mol. Its IUPAC name is cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one.
Molecular Properties
| Compound Name | cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one |
| PubChem CID | 101083109 |
| Molecular Formula | C20H20O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one |
| SMILES | C=C(c1ccccc1)[C@]1(C)CC(=O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H20O/c1-15(16-9-5-3-6-10-16)20(2)14-18(21)13-19(20)17-11-7-4-8-12-17/h3-12,19H,1,13-14H2,2H3/t19-,20+/m1/s1 |
| InChIKey | MENJPUHPXPLTKC-UXHICEINSA-N |
| XLogP | 4.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one?
The IUPAC name of cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one (CID 101083109) is cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one.
What is the SMILES notation for cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one?
The canonical SMILES for cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one is C=C(c1ccccc1)[C@]1(C)CC(=O)C[C@@H]1c1ccccc1.
What is the InChIKey of cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one?
The InChIKey is MENJPUHPXPLTKC-UXHICEINSA-N. The full InChI is InChI=1S/C20H20O/c1-15(16-9-5-3-6-10-16)20(2)14-18(21)13-19(20)17-11-7-4-8-12-17/h3-12,19H,1,13-14H2,2H3/t19-,20+/m1/s1.
What are the key properties of cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one?
cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one has a molecular weight of 276.38 g/mol, XLogP of 4.85, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(3R,4R)-3-methyl-4-phenyl-3-(1-phenylethenyl)cyclopentan-1-one is sourced from PubChem (CID 101083109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).