C20H21NO3S2 — CID 139040154
(3aS,7S,7aS)-3a-hydroxy-7a-methyl-3,7-diphenyl-2-sulfanylidene-6,7-dihydro-4H-1,3-benzothiazol-5-one;hydrate (PubChem CID 139040154) has the molecular formula C20H21NO3S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is (3aS,7S,7aS)-3a-hydroxy-7a-methyl-3,7-diphenyl-2-sulfanylidene-6,7-dihydro-4H-1,3-benzothiazol-5-one;hydrate.
| Compound Name | (3aS,7S,7aS)-3a-hydroxy-7a-methyl-3,7-diphenyl-2-sulfanylidene-6,7-dihydro-4H-1,3-benzothiazol-5-one;hydrate |
|---|---|
| PubChem CID | 139040154 |
| Molecular Formula | C20H21NO3S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | (3aS,7S,7aS)-3a-hydroxy-7a-methyl-3,7-diphenyl-2-sulfanylidene-6,7-dihydro-4H-1,3-benzothiazol-5-one;hydrate |
| SMILES | C[C@@]12SC(=S)N(c3ccccc3)[C@]1(O)CC(=O)C[C@H]2c1ccccc1.O |
| InChI | InChI=1S/C20H19NO2S2.H2O/c1-19-17(14-8-4-2-5-9-14)12-16(22)13-20(19,23)21(18(24)25-19)15-10-6-3-7-11-15;/h2-11,17,23H,12-13H2,1H3;1H2/t17-,19-,20-;/m0./s1 |
| InChIKey | RGSZKIPEGSUCQS-QEXYDYNRSA-N |
| XLogP | 3.29 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|