C19H21NO3 — CID 14471228
3a,6,6-trimethyl-3-phenyl-1,5,7,8b-tetrahydro-[1]benzofuro[2,3-b]pyrrole-2,8-dione (PubChem CID 14471228) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is 3a,6,6-trimethyl-3-phenyl-1,5,7,8b-tetrahydro-[1]benzofuro[2,3-b]pyrrole-2,8-dione.
| Compound Name | 3a,6,6-trimethyl-3-phenyl-1,5,7,8b-tetrahydro-[1]benzofuro[2,3-b]pyrrole-2,8-dione |
|---|---|
| PubChem CID | 14471228 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3a,6,6-trimethyl-3-phenyl-1,5,7,8b-tetrahydro-[1]benzofuro[2,3-b]pyrrole-2,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1(C)C2CC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C19H21NO3/c1-18(2)10-14(21)17-13-9-16(22)20(12-7-5-4-6-8-12)19(13,3)23-15(17)11-18/h4-8,13H,9-11H2,1-3H3 |
| InChIKey | VMVACJODXSDBAO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |