C26H26N2O3 — CID 163793329
(2R,3S)-5'-ethyl-6,6-dimethyl-2',3-diphenylspiro[5,7-dihydro-3H-1-benzofuran-2,4'-pyrazole]-3',4-dione (PubChem CID 163793329) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is (2R,3S)-5'-ethyl-6,6-dimethyl-2',3-diphenylspiro[5,7-dihydro-3H-1-benzofuran-2,4'-pyrazole]-3',4-dione.
| Compound Name | (2R,3S)-5'-ethyl-6,6-dimethyl-2',3-diphenylspiro[5,7-dihydro-3H-1-benzofuran-2,4'-pyrazole]-3',4-dione |
|---|---|
| PubChem CID | 163793329 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (2R,3S)-5'-ethyl-6,6-dimethyl-2',3-diphenylspiro[5,7-dihydro-3H-1-benzofuran-2,4'-pyrazole]-3',4-dione |
| SMILES | CCC1=NN(c2ccccc2)C(=O)[C@]12OC1=C(C(=O)CC(C)(C)C1)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C26H26N2O3/c1-4-21-26(24(30)28(27-21)18-13-9-6-10-14-18)23(17-11-7-5-8-12-17)22-19(29)15-25(2,3)16-20(22)31-26/h5-14,23H,4,15-16H2,1-3H3/t23-,26-/m0/s1 |
| InChIKey | MYSAMNGTWRNRCZ-OZXSUGGESA-N |
| XLogP | 5.00 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |