C23H25BrO4 — CID 102223154
3-(4-bromophenyl)-5',5',6,6-tetramethylspiro[5,7-dihydro-3H-1-benzofuran-2,2'-cyclohexane]-1',3',4-trione (PubChem CID 102223154) has the molecular formula C23H25BrO4 and a molecular weight of 445.35 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5',5',6,6-tetramethylspiro[5,7-dihydro-3H-1-benzofuran-2,2'-cyclohexane]-1',3',4-trione.
| Compound Name | 3-(4-bromophenyl)-5',5',6,6-tetramethylspiro[5,7-dihydro-3H-1-benzofuran-2,2'-cyclohexane]-1',3',4-trione |
|---|---|
| PubChem CID | 102223154 |
| Molecular Formula | C23H25BrO4 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 3-(4-bromophenyl)-5',5',6,6-tetramethylspiro[5,7-dihydro-3H-1-benzofuran-2,2'-cyclohexane]-1',3',4-trione |
| SMILES | CC1(C)CC(=O)C2(OC3=C(C(=O)CC(C)(C)C3)C2c2ccc(Br)cc2)C(=O)C1 |
| InChI | InChI=1S/C23H25BrO4/c1-21(2)9-15(25)19-16(10-21)28-23(17(26)11-22(3,4)12-18(23)27)20(19)13-5-7-14(24)8-6-13/h5-8,20H,9-12H2,1-4H3 |
| InChIKey | DKFFHXFYSIUWFK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|