C25H30O4 — CID 1106078
(2S,4R)-4-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-7,7-dimethyl-2-phenyl-3,4,6,8-tetrahydro-2H-chromen-5-one (PubChem CID 1106078) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is (2S,4R)-4-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-7,7-dimethyl-2-phenyl-3,4,6,8-tetrahydro-2H-chromen-5-one.
| Compound Name | (2S,4R)-4-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-7,7-dimethyl-2-phenyl-3,4,6,8-tetrahydro-2H-chromen-5-one |
|---|---|
| PubChem CID | 1106078 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (2S,4R)-4-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-7,7-dimethyl-2-phenyl-3,4,6,8-tetrahydro-2H-chromen-5-one |
| SMILES | CC1(C)CC(=O)C([C@H]2C[C@@H](c3ccccc3)OC3=C2C(=O)CC(C)(C)C3)=C(O)C1 |
| InChI | InChI=1S/C25H30O4/c1-24(2)11-17(26)22(18(27)12-24)16-10-20(15-8-6-5-7-9-15)29-21-14-25(3,4)13-19(28)23(16)21/h5-9,16,20,26H,10-14H2,1-4H3/t16-,20+/m1/s1 |
| InChIKey | ABRCJYCWTUTXKV-UZLBHIALSA-N |
| XLogP | 5.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |