C16H17NO4 — CID 7408067
(2R,3R)-6,6-dimethyl-2-nitro-3-phenyl-2,3,5,7-tetrahydro-1-benzofuran-4-one (PubChem CID 7408067) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is (2R,3R)-6,6-dimethyl-2-nitro-3-phenyl-2,3,5,7-tetrahydro-1-benzofuran-4-one.
| Compound Name | (2R,3R)-6,6-dimethyl-2-nitro-3-phenyl-2,3,5,7-tetrahydro-1-benzofuran-4-one |
|---|---|
| PubChem CID | 7408067 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (2R,3R)-6,6-dimethyl-2-nitro-3-phenyl-2,3,5,7-tetrahydro-1-benzofuran-4-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)O[C@@H]([N+](=O)[O-])[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C16H17NO4/c1-16(2)8-11(18)14-12(9-16)21-15(17(19)20)13(14)10-6-4-3-5-7-10/h3-7,13,15H,8-9H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | YTRWCCLSIMWTLS-UKRRQHHQSA-N |
| XLogP | 3.05 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|