C30H28N2O8 — CID 102294804
9-(3,3-dimethyl-7-nitro-1-oxo-4,9-dihydro-2H-xanthen-9-yl)-3,3-dimethyl-7-nitro-4,9-dihydro-2H-xanthen-1-one (PubChem CID 102294804) has the molecular formula C30H28N2O8 and a molecular weight of 544.56 g/mol. Its IUPAC name is 9-(3,3-dimethyl-7-nitro-1-oxo-4,9-dihydro-2H-xanthen-9-yl)-3,3-dimethyl-7-nitro-4,9-dihydro-2H-xanthen-1-one.
| Compound Name | 9-(3,3-dimethyl-7-nitro-1-oxo-4,9-dihydro-2H-xanthen-9-yl)-3,3-dimethyl-7-nitro-4,9-dihydro-2H-xanthen-1-one |
|---|---|
| PubChem CID | 102294804 |
| Molecular Formula | C30H28N2O8 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 9-(3,3-dimethyl-7-nitro-1-oxo-4,9-dihydro-2H-xanthen-9-yl)-3,3-dimethyl-7-nitro-4,9-dihydro-2H-xanthen-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Oc1ccc([N+](=O)[O-])cc1C2C1C2=C(CC(C)(C)CC2=O)Oc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C30H28N2O8/c1-29(2)11-19(33)27-23(13-29)39-21-7-5-15(31(35)36)9-17(21)25(27)26-18-10-16(32(37)38)6-8-22(18)40-24-14-30(3,4)12-20(34)28(24)26/h5-10,25-26H,11-14H2,1-4H3 |
| InChIKey | QOQFGMMADFRGOL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|