C19H17ClN2O5 — CID 11843771
9-(2-chloro-5-nitrophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-3H-furo[3,4-b]quinoline-1,8-dione (PubChem CID 11843771) has the molecular formula C19H17ClN2O5 and a molecular weight of 388.81 g/mol. Its IUPAC name is 9-(2-chloro-5-nitrophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-3H-furo[3,4-b]quinoline-1,8-dione.
| Compound Name | 9-(2-chloro-5-nitrophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-3H-furo[3,4-b]quinoline-1,8-dione |
|---|---|
| PubChem CID | 11843771 |
| Molecular Formula | C19H17ClN2O5 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 9-(2-chloro-5-nitrophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-3H-furo[3,4-b]quinoline-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC1=C(C(=O)OC1)C2c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C19H17ClN2O5/c1-19(2)6-12-16(14(23)7-19)15(17-13(21-12)8-27-18(17)24)10-5-9(22(25)26)3-4-11(10)20/h3-5,15,21H,6-8H2,1-2H3 |
| InChIKey | FHPKDLRLXLPCMG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|