C21H24ClNO3 — CID 143018500
9-(2-chlorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-3H-furo[3,4-b]quinoline-1,8-dione;ethane (PubChem CID 143018500) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is 9-(2-chlorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-3H-furo[3,4-b]quinoline-1,8-dione;ethane.
| Compound Name | 9-(2-chlorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-3H-furo[3,4-b]quinoline-1,8-dione;ethane |
|---|---|
| PubChem CID | 143018500 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 9-(2-chlorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-3H-furo[3,4-b]quinoline-1,8-dione;ethane |
| SMILES | CC.CC1(C)CC(=O)C2=C(C1)NC1=C(C(=O)OC1)C2c1ccccc1Cl |
| InChI | InChI=1S/C19H18ClNO3.C2H6/c1-19(2)7-12-16(14(22)8-19)15(10-5-3-4-6-11(10)20)17-13(21-12)9-24-18(17)23;1-2/h3-6,15,21H,7-9H2,1-2H3;1-2H3 |
| InChIKey | SILUCTBCTVWAEH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |