C15H15NO4 — CID 25172407
3,3-dimethyl-7-nitro-4,9-dihydro-2H-xanthen-1-one (PubChem CID 25172407) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3,3-dimethyl-7-nitro-4,9-dihydro-2H-xanthen-1-one.
| Compound Name | 3,3-dimethyl-7-nitro-4,9-dihydro-2H-xanthen-1-one |
|---|---|
| PubChem CID | 25172407 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3,3-dimethyl-7-nitro-4,9-dihydro-2H-xanthen-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Oc1ccc([N+](=O)[O-])cc1C2 |
| InChI | InChI=1S/C15H15NO4/c1-15(2)7-12(17)11-6-9-5-10(16(18)19)3-4-13(9)20-14(11)8-15/h3-5H,6-8H2,1-2H3 |
| InChIKey | DHRLUVKPDLZCEZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|