C13H15NO3 — CID 102583772
2-but-3-enyl-2-methyl-5-nitro-3H-1-benzofuran (PubChem CID 102583772) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-but-3-enyl-2-methyl-5-nitro-3H-1-benzofuran.
| Compound Name | 2-but-3-enyl-2-methyl-5-nitro-3H-1-benzofuran |
|---|---|
| PubChem CID | 102583772 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-but-3-enyl-2-methyl-5-nitro-3H-1-benzofuran |
| SMILES | C=CCCC1(C)Cc2cc([N+](=O)[O-])ccc2O1 |
| InChI | InChI=1S/C13H15NO3/c1-3-4-7-13(2)9-10-8-11(14(15)16)5-6-12(10)17-13/h3,5-6,8H,1,4,7,9H2,2H3 |
| InChIKey | XDMVPXFEHDSBHR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|