C9H6N2O7 — CID 152563895
2,5-dinitro-3H-1-benzofuran-2-carboxylic acid (PubChem CID 152563895) has the molecular formula C9H6N2O7 and a molecular weight of 254.15 g/mol. Its IUPAC name is 2,5-dinitro-3H-1-benzofuran-2-carboxylic acid.
| Compound Name | 2,5-dinitro-3H-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 152563895 |
| Molecular Formula | C9H6N2O7 |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 2,5-dinitro-3H-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(O)C1([N+](=O)[O-])Cc2cc([N+](=O)[O-])ccc2O1 |
| InChI | InChI=1S/C9H6N2O7/c12-8(13)9(11(16)17)4-5-3-6(10(14)15)1-2-7(5)18-9/h1-3H,4H2,(H,12,13) |
| InChIKey | YQBLGXZBHPEPJI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|