C16H20N2O4 — CID 58199306
1'-cyclobutyl-6-nitrospiro[4H-1,3-benzodioxine-2,4'-piperidine] (PubChem CID 58199306) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1'-cyclobutyl-6-nitrospiro[4H-1,3-benzodioxine-2,4'-piperidine].
| Compound Name | 1'-cyclobutyl-6-nitrospiro[4H-1,3-benzodioxine-2,4'-piperidine] |
|---|---|
| PubChem CID | 58199306 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1'-cyclobutyl-6-nitrospiro[4H-1,3-benzodioxine-2,4'-piperidine] |
| SMILES | O=[N+]([O-])c1ccc2c(c1)COC1(CCN(C3CCC3)CC1)O2 |
| InChI | InChI=1S/C16H20N2O4/c19-18(20)14-4-5-15-12(10-14)11-21-16(22-15)6-8-17(9-7-16)13-2-1-3-13/h4-5,10,13H,1-3,6-9,11H2 |
| InChIKey | JVZOJJVLPNJIGB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|