C24H24ClN3O3 — CID 143841903
2-chloro-N-cyano-4-(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzamide (PubChem CID 143841903) has the molecular formula C24H24ClN3O3 and a molecular weight of 437.93 g/mol. Its IUPAC name is 2-chloro-N-cyano-4-(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzamide.
| Compound Name | 2-chloro-N-cyano-4-(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzamide |
|---|---|
| PubChem CID | 143841903 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-chloro-N-cyano-4-(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)benzamide |
| SMILES | N#CNC(=O)c1ccc(-c2ccc3c(c2)COC2(CCN(C4CCC4)CC2)O3)cc1Cl |
| InChI | InChI=1S/C24H24ClN3O3/c25-21-13-17(4-6-20(21)23(29)27-15-26)16-5-7-22-18(12-16)14-30-24(31-22)8-10-28(11-9-24)19-2-1-3-19/h4-7,12-13,19H,1-3,8-11,14H2,(H,27,29) |
| InChIKey | CYZVGOBTWHOHOO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|