C18H18N2O3 — CID 139243709
5a,6,10b-trimethyl-2-nitro-11H-chromeno[2,3-b]indole (PubChem CID 139243709) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 5a,6,10b-trimethyl-2-nitro-11H-chromeno[2,3-b]indole.
| Compound Name | 5a,6,10b-trimethyl-2-nitro-11H-chromeno[2,3-b]indole |
|---|---|
| PubChem CID | 139243709 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 5a,6,10b-trimethyl-2-nitro-11H-chromeno[2,3-b]indole |
| SMILES | CN1c2ccccc2C2(C)Cc3cc([N+](=O)[O-])ccc3OC12C |
| InChI | InChI=1S/C18H18N2O3/c1-17-11-12-10-13(20(21)22)8-9-16(12)23-18(17,2)19(3)15-7-5-4-6-14(15)17/h4-10H,11H2,1-3H3 |
| InChIKey | ASAHHMWCBUCVJT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|