C34H30N2O3 — CID 90895737
5a,6,6-trimethyl-2-nitro-8-[2-[4-(2-phenylethenyl)phenyl]ethenyl]-12H-indolo[2,1-b][1,3]benzoxazine (PubChem CID 90895737) has the molecular formula C34H30N2O3 and a molecular weight of 514.63 g/mol. Its IUPAC name is 5a,6,6-trimethyl-2-nitro-8-[2-[4-(2-phenylethenyl)phenyl]ethenyl]-12H-indolo[2,1-b][1,3]benzoxazine.
| Compound Name | 5a,6,6-trimethyl-2-nitro-8-[2-[4-(2-phenylethenyl)phenyl]ethenyl]-12H-indolo[2,1-b][1,3]benzoxazine |
|---|---|
| PubChem CID | 90895737 |
| Molecular Formula | C34H30N2O3 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 5a,6,6-trimethyl-2-nitro-8-[2-[4-(2-phenylethenyl)phenyl]ethenyl]-12H-indolo[2,1-b][1,3]benzoxazine |
| SMILES | CC1(C)c2cc(C=Cc3ccc(C=Cc4ccccc4)cc3)ccc2N2Cc3cc([N+](=O)[O-])ccc3OC21C |
| InChI | InChI=1S/C34H30N2O3/c1-33(2)30-21-27(16-15-26-13-11-25(12-14-26)10-9-24-7-5-4-6-8-24)17-19-31(30)35-23-28-22-29(36(37)38)18-20-32(28)39-34(33,35)3/h4-22H,23H2,1-3H3 |
| InChIKey | SOUKZRYBOFAVES-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|