C28H29N3O4 — CID 164669003
4-[(E)-2-(4-methoxy-6,6-dimethyl-2-nitro-12H-indolo[2,1-b][1,3]benzoxazin-5a-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 164669003) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4-[(E)-2-(4-methoxy-6,6-dimethyl-2-nitro-12H-indolo[2,1-b][1,3]benzoxazin-5a-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-(4-methoxy-6,6-dimethyl-2-nitro-12H-indolo[2,1-b][1,3]benzoxazin-5a-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 164669003 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 4-[(E)-2-(4-methoxy-6,6-dimethyl-2-nitro-12H-indolo[2,1-b][1,3]benzoxazin-5a-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | COc1cc([N+](=O)[O-])cc2c1OC1(/C=C/c3ccc(N(C)C)cc3)N(C2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C28H29N3O4/c1-27(2)23-8-6-7-9-24(23)30-18-20-16-22(31(32)33)17-25(34-5)26(20)35-28(27,30)15-14-19-10-12-21(13-11-19)29(3)4/h6-17H,18H2,1-5H3/b15-14+ |
| InChIKey | ATZXSVQYIOCWJM-CCEZHUSRSA-N |
| XLogP | 5.77 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|