C22H28N2O — CID 143745989
4-[(E)-2-(2-methoxy-1,3,3-trimethylindol-2-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 143745989) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 4-[(E)-2-(2-methoxy-1,3,3-trimethylindol-2-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-(2-methoxy-1,3,3-trimethylindol-2-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 143745989 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 4-[(E)-2-(2-methoxy-1,3,3-trimethylindol-2-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | COC1(/C=C/c2ccc(N(C)C)cc2)N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C22H28N2O/c1-21(2)19-9-7-8-10-20(19)24(5)22(21,25-6)16-15-17-11-13-18(14-12-17)23(3)4/h7-16H,1-6H3/b16-15+ |
| InChIKey | GDIRSBAPYRZAPP-FOCLMDBBSA-N |
| XLogP | 4.54 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|