C24H30N2 — CID 154529819
N,N-diethyl-4-[(E)-2-(1,4,4-trimethylquinolin-3-yl)ethenyl]aniline (PubChem CID 154529819) has the molecular formula C24H30N2 and a molecular weight of 346.52 g/mol. Its IUPAC name is N,N-diethyl-4-[(E)-2-(1,4,4-trimethylquinolin-3-yl)ethenyl]aniline.
| Compound Name | N,N-diethyl-4-[(E)-2-(1,4,4-trimethylquinolin-3-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 154529819 |
| Molecular Formula | C24H30N2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N,N-diethyl-4-[(E)-2-(1,4,4-trimethylquinolin-3-yl)ethenyl]aniline |
| SMILES | CCN(CC)c1ccc(/C=C/C2=CN(C)c3ccccc3C2(C)C)cc1 |
| InChI | InChI=1S/C24H30N2/c1-6-26(7-2)21-16-13-19(14-17-21)12-15-20-18-25(5)23-11-9-8-10-22(23)24(20,3)4/h8-18H,6-7H2,1-5H3/b15-12+ |
| InChIKey | ZGWFRSDOQYLYQT-NTCAYCPXSA-N |
| XLogP | 5.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|