C24H29N3O — CID 98472174
(4R,10aR)-10a-[(Z)-2-[4-(dimethylamino)phenyl]ethenyl]-4,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one (PubChem CID 98472174) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is (4R,10aR)-10a-[(Z)-2-[4-(dimethylamino)phenyl]ethenyl]-4,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one.
| Compound Name | (4R,10aR)-10a-[(Z)-2-[4-(dimethylamino)phenyl]ethenyl]-4,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one |
|---|---|
| PubChem CID | 98472174 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (4R,10aR)-10a-[(Z)-2-[4-(dimethylamino)phenyl]ethenyl]-4,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one |
| SMILES | C[C@@H]1CC(=O)N[C@]2(/C=C\c3ccc(N(C)C)cc3)N1c1ccccc1C2(C)C |
| InChI | InChI=1S/C24H29N3O/c1-17-16-22(28)25-24(15-14-18-10-12-19(13-11-18)26(4)5)23(2,3)20-8-6-7-9-21(20)27(17)24/h6-15,17H,16H2,1-5H3,(H,25,28)/b15-14-/t17-,24-/m1/s1 |
| InChIKey | QDLUIPKHEOLEDQ-WXGGUIGUSA-N |
| XLogP | 4.17 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|