C22H24BrN3O — CID 6582076
(3aR)-6-bromo-3a-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-4,4-dimethyl-1,3-dihydroimidazo[1,2-a]indol-2-one (PubChem CID 6582076) has the molecular formula C22H24BrN3O and a molecular weight of 426.36 g/mol. Its IUPAC name is (3aR)-6-bromo-3a-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-4,4-dimethyl-1,3-dihydroimidazo[1,2-a]indol-2-one.
| Compound Name | (3aR)-6-bromo-3a-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-4,4-dimethyl-1,3-dihydroimidazo[1,2-a]indol-2-one |
|---|---|
| PubChem CID | 6582076 |
| Molecular Formula | C22H24BrN3O |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | (3aR)-6-bromo-3a-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-4,4-dimethyl-1,3-dihydroimidazo[1,2-a]indol-2-one |
| SMILES | CN(C)c1ccc(/C=C/[C@@]23NC(=O)CN2c2ccc(Br)cc2C3(C)C)cc1 |
| InChI | InChI=1S/C22H24BrN3O/c1-21(2)18-13-16(23)7-10-19(18)26-14-20(27)24-22(21,26)12-11-15-5-8-17(9-6-15)25(3)4/h5-13H,14H2,1-4H3,(H,24,27)/b12-11+/t22-/m1/s1 |
| InChIKey | KGZUVUNFFZRBDN-VDZCTEQFSA-N |
| XLogP | 4.15 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|