C21H20BrN3O3 — CID 41003741
(10aS)-8-bromo-10,10-dimethyl-10a-[(E)-2-(3-nitrophenyl)ethenyl]-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one (PubChem CID 41003741) has the molecular formula C21H20BrN3O3 and a molecular weight of 442.31 g/mol. Its IUPAC name is (10aS)-8-bromo-10,10-dimethyl-10a-[(E)-2-(3-nitrophenyl)ethenyl]-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one.
| Compound Name | (10aS)-8-bromo-10,10-dimethyl-10a-[(E)-2-(3-nitrophenyl)ethenyl]-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one |
|---|---|
| PubChem CID | 41003741 |
| Molecular Formula | C21H20BrN3O3 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | (10aS)-8-bromo-10,10-dimethyl-10a-[(E)-2-(3-nitrophenyl)ethenyl]-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one |
| SMILES | CC1(C)c2cc(Br)ccc2N2CCC(=O)N[C@@]21/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H20BrN3O3/c1-20(2)17-13-15(22)6-7-18(17)24-11-9-19(26)23-21(20,24)10-8-14-4-3-5-16(12-14)25(27)28/h3-8,10,12-13H,9,11H2,1-2H3,(H,23,26)/b10-8+/t21-/m0/s1 |
| InChIKey | YTIDZAJDSWRMEB-DJGBTNNQSA-N |
| XLogP | 4.38 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|