C22H22Cl2N2O — CID 4892320
10a-[2-(2,3-dichlorophenyl)ethenyl]-8,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one (PubChem CID 4892320) has the molecular formula C22H22Cl2N2O and a molecular weight of 401.34 g/mol. Its IUPAC name is 10a-[2-(2,3-dichlorophenyl)ethenyl]-8,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one.
| Compound Name | 10a-[2-(2,3-dichlorophenyl)ethenyl]-8,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one |
|---|---|
| PubChem CID | 4892320 |
| Molecular Formula | C22H22Cl2N2O |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 10a-[2-(2,3-dichlorophenyl)ethenyl]-8,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one |
| SMILES | Cc1ccc2c(c1)C(C)(C)C1(C=Cc3cccc(Cl)c3Cl)NC(=O)CCN21 |
| InChI | InChI=1S/C22H22Cl2N2O/c1-14-7-8-18-16(13-14)21(2,3)22(25-19(27)10-12-26(18)22)11-9-15-5-4-6-17(23)20(15)24/h4-9,11,13H,10,12H2,1-3H3,(H,25,27) |
| InChIKey | MXNXODFIRNZDGU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |