C26H33N3O — CID 92909788
(10aS)-10a-[(Z)-2-[4-(diethylamino)phenyl]ethenyl]-8,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one (PubChem CID 92909788) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is (10aS)-10a-[(Z)-2-[4-(diethylamino)phenyl]ethenyl]-8,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one.
| Compound Name | (10aS)-10a-[(Z)-2-[4-(diethylamino)phenyl]ethenyl]-8,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one |
|---|---|
| PubChem CID | 92909788 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | (10aS)-10a-[(Z)-2-[4-(diethylamino)phenyl]ethenyl]-8,10,10-trimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one |
| SMILES | CCN(CC)c1ccc(/C=C\[C@]23NC(=O)CCN2c2ccc(C)cc2C3(C)C)cc1 |
| InChI | InChI=1S/C26H33N3O/c1-6-28(7-2)21-11-9-20(10-12-21)14-16-26-25(4,5)22-18-19(3)8-13-23(22)29(26)17-15-24(30)27-26/h8-14,16,18H,6-7,15,17H2,1-5H3,(H,27,30)/b16-14-/t26-/m0/s1 |
| InChIKey | ZVCKZDBRKSRQPF-LUYCFMQYSA-N |
| XLogP | 4.87 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|