C14H17NO2 — CID 122204762
3a,4,4-trimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indole-6-carbaldehyde (PubChem CID 122204762) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 3a,4,4-trimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indole-6-carbaldehyde.
| Compound Name | 3a,4,4-trimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indole-6-carbaldehyde |
|---|---|
| PubChem CID | 122204762 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 3a,4,4-trimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indole-6-carbaldehyde |
| SMILES | CC1(C)c2cc(C=O)ccc2N2CCOC21C |
| InChI | InChI=1S/C14H17NO2/c1-13(2)11-8-10(9-16)4-5-12(11)15-6-7-17-14(13,15)3/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | WCOUICOJIMJKNB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|