C10H11NO5 — CID 86089329
2-(2-methyl-5-nitro-1,3-benzodioxol-2-yl)ethanol (PubChem CID 86089329) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is 2-(2-methyl-5-nitro-1,3-benzodioxol-2-yl)ethanol.
| Compound Name | 2-(2-methyl-5-nitro-1,3-benzodioxol-2-yl)ethanol |
|---|---|
| PubChem CID | 86089329 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2-(2-methyl-5-nitro-1,3-benzodioxol-2-yl)ethanol |
| SMILES | CC1(CCO)Oc2ccc([N+](=O)[O-])cc2O1 |
| InChI | InChI=1S/C10H11NO5/c1-10(4-5-12)15-8-3-2-7(11(13)14)6-9(8)16-10/h2-3,6,12H,4-5H2,1H3 |
| InChIKey | OOCDFYMQXAZHSA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|