C26H23NO5 — CID 56964203
2-methoxy-9,9-dimethyl-12-(4-nitrophenyl)-10,12-dihydro-8H-benzo[a]xanthen-11-one (PubChem CID 56964203) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is 2-methoxy-9,9-dimethyl-12-(4-nitrophenyl)-10,12-dihydro-8H-benzo[a]xanthen-11-one.
| Compound Name | 2-methoxy-9,9-dimethyl-12-(4-nitrophenyl)-10,12-dihydro-8H-benzo[a]xanthen-11-one |
|---|---|
| PubChem CID | 56964203 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-methoxy-9,9-dimethyl-12-(4-nitrophenyl)-10,12-dihydro-8H-benzo[a]xanthen-11-one |
| SMILES | COc1ccc2ccc3c(c2c1)C(c1ccc([N+](=O)[O-])cc1)C1=C(CC(C)(C)CC1=O)O3 |
| InChI | InChI=1S/C26H23NO5/c1-26(2)13-20(28)25-22(14-26)32-21-11-7-15-6-10-18(31-3)12-19(15)24(21)23(25)16-4-8-17(9-5-16)27(29)30/h4-12,23H,13-14H2,1-3H3 |
| InChIKey | GUZWWYRYAIYYJW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|