C19H19NO3S — CID 3302837
4-(4-methoxyphenyl)-7,7-dimethyl-5-oxo-2-sulfanyl-6,8-dihydro-4H-chromene-3-carbonitrile (PubChem CID 3302837) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-7,7-dimethyl-5-oxo-2-sulfanyl-6,8-dihydro-4H-chromene-3-carbonitrile.
| Compound Name | 4-(4-methoxyphenyl)-7,7-dimethyl-5-oxo-2-sulfanyl-6,8-dihydro-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 3302837 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 4-(4-methoxyphenyl)-7,7-dimethyl-5-oxo-2-sulfanyl-6,8-dihydro-4H-chromene-3-carbonitrile |
| SMILES | COc1ccc(C2C(C#N)=C(S)OC3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C19H19NO3S/c1-19(2)8-14(21)17-15(9-19)23-18(24)13(10-20)16(17)11-4-6-12(22-3)7-5-11/h4-7,16,24H,8-9H2,1-3H3 |
| InChIKey | BUWLWCCQOSIKBP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|