C23H21NO5 — CID 139262394
3,3-dimethyl-9-[2-(4-nitrophenyl)-2-oxoethyl]-4,9-dihydro-2H-xanthen-1-one (PubChem CID 139262394) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is 3,3-dimethyl-9-[2-(4-nitrophenyl)-2-oxoethyl]-4,9-dihydro-2H-xanthen-1-one.
| Compound Name | 3,3-dimethyl-9-[2-(4-nitrophenyl)-2-oxoethyl]-4,9-dihydro-2H-xanthen-1-one |
|---|---|
| PubChem CID | 139262394 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3,3-dimethyl-9-[2-(4-nitrophenyl)-2-oxoethyl]-4,9-dihydro-2H-xanthen-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Oc1ccccc1C2CC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H21NO5/c1-23(2)12-19(26)22-17(16-5-3-4-6-20(16)29-21(22)13-23)11-18(25)14-7-9-15(10-8-14)24(27)28/h3-10,17H,11-13H2,1-2H3 |
| InChIKey | JFAGCWDWVACGEZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|