C21H19NO7 — CID 139229895
2-(hydroxymethyl)-7,7-dimethyl-10-(2-nitrophenyl)-8,10-dihydro-6H-pyrano[3,2-b]chromene-4,9-dione (PubChem CID 139229895) has the molecular formula C21H19NO7 and a molecular weight of 397.38 g/mol. Its IUPAC name is 2-(hydroxymethyl)-7,7-dimethyl-10-(2-nitrophenyl)-8,10-dihydro-6H-pyrano[3,2-b]chromene-4,9-dione.
| Compound Name | 2-(hydroxymethyl)-7,7-dimethyl-10-(2-nitrophenyl)-8,10-dihydro-6H-pyrano[3,2-b]chromene-4,9-dione |
|---|---|
| PubChem CID | 139229895 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-(hydroxymethyl)-7,7-dimethyl-10-(2-nitrophenyl)-8,10-dihydro-6H-pyrano[3,2-b]chromene-4,9-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)Oc1c(oc(CO)cc1=O)C2c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H19NO7/c1-21(2)8-15(25)18-16(9-21)29-19-14(24)7-11(10-23)28-20(19)17(18)12-5-3-4-6-13(12)22(26)27/h3-7,17,23H,8-10H2,1-2H3 |
| InChIKey | NMZPLPCJZIUAEG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 119.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|