C26H21N3O4 — CID 134955852
2-(1H-indol-3-yl)-7,7-dimethyl-4-(2-nitrophenyl)-5-oxo-6,8-dihydro-4H-chromene-3-carbonitrile (PubChem CID 134955852) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-7,7-dimethyl-4-(2-nitrophenyl)-5-oxo-6,8-dihydro-4H-chromene-3-carbonitrile.
| Compound Name | 2-(1H-indol-3-yl)-7,7-dimethyl-4-(2-nitrophenyl)-5-oxo-6,8-dihydro-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 134955852 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-(1H-indol-3-yl)-7,7-dimethyl-4-(2-nitrophenyl)-5-oxo-6,8-dihydro-4H-chromene-3-carbonitrile |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC(c1c[nH]c3ccccc13)=C(C#N)C2c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H21N3O4/c1-26(2)11-21(30)24-22(12-26)33-25(18-14-28-19-9-5-3-7-15(18)19)17(13-27)23(24)16-8-4-6-10-20(16)29(31)32/h3-10,14,23,28H,11-12H2,1-2H3 |
| InChIKey | QSRXZYKCYLSJKH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 109.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|