C21H15FN4O3 — CID 102367070
4-(2-fluorophenyl)-2-(1H-indol-3-yl)-6-(methylamino)-5-nitro-4H-pyran-3-carbonitrile (PubChem CID 102367070) has the molecular formula C21H15FN4O3 and a molecular weight of 390.37 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-2-(1H-indol-3-yl)-6-(methylamino)-5-nitro-4H-pyran-3-carbonitrile.
| Compound Name | 4-(2-fluorophenyl)-2-(1H-indol-3-yl)-6-(methylamino)-5-nitro-4H-pyran-3-carbonitrile |
|---|---|
| PubChem CID | 102367070 |
| Molecular Formula | C21H15FN4O3 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 4-(2-fluorophenyl)-2-(1H-indol-3-yl)-6-(methylamino)-5-nitro-4H-pyran-3-carbonitrile |
| SMILES | CNC1=C([N+](=O)[O-])C(c2ccccc2F)C(C#N)=C(c2c[nH]c3ccccc23)O1 |
| InChI | InChI=1S/C21H15FN4O3/c1-24-21-19(26(27)28)18(13-7-2-4-8-16(13)22)14(10-23)20(29-21)15-11-25-17-9-5-3-6-12(15)17/h2-9,11,18,24-25H,1H3 |
| InChIKey | GZSAGOHVTLCYAW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 103.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|