C24H18N6O4 — CID 102451698
7-(1H-indol-3-yl)-1,3-dimethyl-5-(4-nitrophenyl)-2,4-dioxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 102451698) has the molecular formula C24H18N6O4 and a molecular weight of 454.45 g/mol. Its IUPAC name is 7-(1H-indol-3-yl)-1,3-dimethyl-5-(4-nitrophenyl)-2,4-dioxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | 7-(1H-indol-3-yl)-1,3-dimethyl-5-(4-nitrophenyl)-2,4-dioxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 102451698 |
| Molecular Formula | C24H18N6O4 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 7-(1H-indol-3-yl)-1,3-dimethyl-5-(4-nitrophenyl)-2,4-dioxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)C(c1ccc([N+](=O)[O-])cc1)C(C#N)=C(c1c[nH]c3ccccc13)N2 |
| InChI | InChI=1S/C24H18N6O4/c1-28-22-20(23(31)29(2)24(28)32)19(13-7-9-14(10-8-13)30(33)34)16(11-25)21(27-22)17-12-26-18-6-4-3-5-15(17)18/h3-10,12,19,26-27H,1-2H3 |
| InChIKey | UAIQLZDIGHAXPO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|