C31H22N4O7 — CID 1371640
[4-[(2S)-5,7-dimethyl-4,6,17-trioxo-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaen-2-yl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 1371640) has the molecular formula C31H22N4O7 and a molecular weight of 562.54 g/mol. Its IUPAC name is [4-[(2S)-5,7-dimethyl-4,6,17-trioxo-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaen-2-yl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [4-[(2S)-5,7-dimethyl-4,6,17-trioxo-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaen-2-yl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 1371640 |
| Molecular Formula | C31H22N4O7 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | [4-[(2S)-5,7-dimethyl-4,6,17-trioxo-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaen-2-yl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)[C@@H](c1ccc(OC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)cc1)C1=C(N2)c2ccccc2C1=O |
| InChI | InChI=1S/C31H22N4O7/c1-33-29-26(30(38)34(2)31(33)39)24(25-27(32-29)21-5-3-4-6-22(21)28(25)37)18-10-14-20(15-11-18)42-23(36)16-9-17-7-12-19(13-8-17)35(40)41/h3-16,24,32H,1-2H3/b16-9+/t24-/m0/s1 |
| InChIKey | PDESTUDWFLPLCN-OMHSXHNCSA-N |
| XLogP | 3.78 |
| TPSA | 142.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|