C29H23N3O4 — CID 1286461
(2R)-5,7-dimethyl-2-(4-phenylmethoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-4,6,17-trione (PubChem CID 1286461) has the molecular formula C29H23N3O4 and a molecular weight of 477.52 g/mol. Its IUPAC name is (2R)-5,7-dimethyl-2-(4-phenylmethoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-4,6,17-trione.
| Compound Name | (2R)-5,7-dimethyl-2-(4-phenylmethoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-4,6,17-trione |
|---|---|
| PubChem CID | 1286461 |
| Molecular Formula | C29H23N3O4 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | (2R)-5,7-dimethyl-2-(4-phenylmethoxyphenyl)-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaene-4,6,17-trione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)[C@H](c1ccc(OCc3ccccc3)cc1)C1=C(N2)c2ccccc2C1=O |
| InChI | InChI=1S/C29H23N3O4/c1-31-27-24(28(34)32(2)29(31)35)22(23-25(30-27)20-10-6-7-11-21(20)26(23)33)18-12-14-19(15-13-18)36-16-17-8-4-3-5-9-17/h3-15,22,30H,16H2,1-2H3/t22-/m1/s1 |
| InChIKey | YDMWIIMUIAEINE-JOCHJYFZSA-N |
| XLogP | 3.83 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |