C20H16FN3O4 — CID 102494073
4-(4-fluorophenyl)-6-methyl-2-(methylamino)-3-nitro-4H-pyrano[3,2-c]quinolin-5-one (PubChem CID 102494073) has the molecular formula C20H16FN3O4 and a molecular weight of 381.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-6-methyl-2-(methylamino)-3-nitro-4H-pyrano[3,2-c]quinolin-5-one.
| Compound Name | 4-(4-fluorophenyl)-6-methyl-2-(methylamino)-3-nitro-4H-pyrano[3,2-c]quinolin-5-one |
|---|---|
| PubChem CID | 102494073 |
| Molecular Formula | C20H16FN3O4 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 4-(4-fluorophenyl)-6-methyl-2-(methylamino)-3-nitro-4H-pyrano[3,2-c]quinolin-5-one |
| SMILES | CNC1=C([N+](=O)[O-])C(c2ccc(F)cc2)c2c(c3ccccc3n(C)c2=O)O1 |
| InChI | InChI=1S/C20H16FN3O4/c1-22-19-17(24(26)27)15(11-7-9-12(21)10-8-11)16-18(28-19)13-5-3-4-6-14(13)23(2)20(16)25/h3-10,15,22H,1-2H3 |
| InChIKey | XOTFQEBDLSCCGN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|