C20H19N3O2 — CID 163197017
2-amino-4-(1H-indol-3-yl)-3-isocyano-7,7-dimethyl-6,8-dihydro-4H-chromen-5-one (PubChem CID 163197017) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-amino-4-(1H-indol-3-yl)-3-isocyano-7,7-dimethyl-6,8-dihydro-4H-chromen-5-one.
| Compound Name | 2-amino-4-(1H-indol-3-yl)-3-isocyano-7,7-dimethyl-6,8-dihydro-4H-chromen-5-one |
|---|---|
| PubChem CID | 163197017 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-amino-4-(1H-indol-3-yl)-3-isocyano-7,7-dimethyl-6,8-dihydro-4H-chromen-5-one |
| SMILES | [C-]#[N+]C1=C(N)OC2=C(C(=O)CC(C)(C)C2)C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H19N3O2/c1-20(2)8-14(24)17-15(9-20)25-19(21)18(22-3)16(17)12-10-23-13-7-5-4-6-11(12)13/h4-7,10,16,23H,8-9,21H2,1-2H3 |
| InChIKey | DEWCCGJPUFKCET-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|