C29H24BrNO2 — CID 102457353
7-bromo-3,3-dimethyl-9-(2-phenyl-1H-indol-3-yl)-4,9-dihydro-2H-xanthen-1-one (PubChem CID 102457353) has the molecular formula C29H24BrNO2 and a molecular weight of 498.42 g/mol. Its IUPAC name is 7-bromo-3,3-dimethyl-9-(2-phenyl-1H-indol-3-yl)-4,9-dihydro-2H-xanthen-1-one.
| Compound Name | 7-bromo-3,3-dimethyl-9-(2-phenyl-1H-indol-3-yl)-4,9-dihydro-2H-xanthen-1-one |
|---|---|
| PubChem CID | 102457353 |
| Molecular Formula | C29H24BrNO2 |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 7-bromo-3,3-dimethyl-9-(2-phenyl-1H-indol-3-yl)-4,9-dihydro-2H-xanthen-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Oc1ccc(Br)cc1C2c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C29H24BrNO2/c1-29(2)15-22(32)27-24(16-29)33-23-13-12-18(30)14-20(23)25(27)26-19-10-6-7-11-21(19)31-28(26)17-8-4-3-5-9-17/h3-14,25,31H,15-16H2,1-2H3 |
| InChIKey | PSWUWENUJLLAKC-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |