C18H22O2S — CID 102124800
3,3-dimethyl-9-propylsulfanyl-4,9-dihydro-2H-xanthen-1-one (PubChem CID 102124800) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is 3,3-dimethyl-9-propylsulfanyl-4,9-dihydro-2H-xanthen-1-one.
| Compound Name | 3,3-dimethyl-9-propylsulfanyl-4,9-dihydro-2H-xanthen-1-one |
|---|---|
| PubChem CID | 102124800 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 3,3-dimethyl-9-propylsulfanyl-4,9-dihydro-2H-xanthen-1-one |
| SMILES | CCCSC1C2=C(CC(C)(C)CC2=O)Oc2ccccc21 |
| InChI | InChI=1S/C18H22O2S/c1-4-9-21-17-12-7-5-6-8-14(12)20-15-11-18(2,3)10-13(19)16(15)17/h5-8,17H,4,9-11H2,1-3H3 |
| InChIKey | RTYBVYSNVFTAJY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |