C21H20O5 — CID 164577008
4-(3,3-dimethyl-1-oxo-4,9-dihydro-2H-xanthen-9-yl)-5-hydroxycyclohex-4-ene-1,3-dione (PubChem CID 164577008) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is 4-(3,3-dimethyl-1-oxo-4,9-dihydro-2H-xanthen-9-yl)-5-hydroxycyclohex-4-ene-1,3-dione.
| Compound Name | 4-(3,3-dimethyl-1-oxo-4,9-dihydro-2H-xanthen-9-yl)-5-hydroxycyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 164577008 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 4-(3,3-dimethyl-1-oxo-4,9-dihydro-2H-xanthen-9-yl)-5-hydroxycyclohex-4-ene-1,3-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)Oc1ccccc1C2C1=C(O)CC(=O)CC1=O |
| InChI | InChI=1S/C21H20O5/c1-21(2)9-15(25)20-17(10-21)26-16-6-4-3-5-12(16)18(20)19-13(23)7-11(22)8-14(19)24/h3-6,18,23H,7-10H2,1-2H3 |
| InChIKey | ZZWYMMPIZDOWAL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|