C22H24O2 — CID 138976712
9,9-dimethyl-12-propyl-10,12-dihydro-8H-benzo[a]xanthen-11-one (PubChem CID 138976712) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is 9,9-dimethyl-12-propyl-10,12-dihydro-8H-benzo[a]xanthen-11-one.
| Compound Name | 9,9-dimethyl-12-propyl-10,12-dihydro-8H-benzo[a]xanthen-11-one |
|---|---|
| PubChem CID | 138976712 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 9,9-dimethyl-12-propyl-10,12-dihydro-8H-benzo[a]xanthen-11-one |
| SMILES | CCCC1C2=C(CC(C)(C)CC2=O)Oc2ccc3ccccc3c21 |
| InChI | InChI=1S/C22H24O2/c1-4-7-16-20-15-9-6-5-8-14(15)10-11-18(20)24-19-13-22(2,3)12-17(23)21(16)19/h5-6,8-11,16H,4,7,12-13H2,1-3H3 |
| InChIKey | ADJATMLVDMXFNM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |