C23H21NO4 — CID 102470484
7,7-dimethyl-4-(4-nitrophenyl)-2-phenyl-6,8-dihydro-4H-chromen-5-one (PubChem CID 102470484) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is 7,7-dimethyl-4-(4-nitrophenyl)-2-phenyl-6,8-dihydro-4H-chromen-5-one.
| Compound Name | 7,7-dimethyl-4-(4-nitrophenyl)-2-phenyl-6,8-dihydro-4H-chromen-5-one |
|---|---|
| PubChem CID | 102470484 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 7,7-dimethyl-4-(4-nitrophenyl)-2-phenyl-6,8-dihydro-4H-chromen-5-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC(c1ccccc1)=CC2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H21NO4/c1-23(2)13-19(25)22-18(15-8-10-17(11-9-15)24(26)27)12-20(28-21(22)14-23)16-6-4-3-5-7-16/h3-12,18H,13-14H2,1-2H3 |
| InChIKey | XFWCFYITFVPTOV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|