C23H22N2O4 — CID 102037395
4-(4-hydroxy-3-nitrophenyl)-7,7-dimethyl-2-phenyl-1,4,6,8-tetrahydroquinolin-5-one (PubChem CID 102037395) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 4-(4-hydroxy-3-nitrophenyl)-7,7-dimethyl-2-phenyl-1,4,6,8-tetrahydroquinolin-5-one.
| Compound Name | 4-(4-hydroxy-3-nitrophenyl)-7,7-dimethyl-2-phenyl-1,4,6,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 102037395 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 4-(4-hydroxy-3-nitrophenyl)-7,7-dimethyl-2-phenyl-1,4,6,8-tetrahydroquinolin-5-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC(c1ccccc1)=CC2c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H22N2O4/c1-23(2)12-18-22(21(27)13-23)16(11-17(24-18)14-6-4-3-5-7-14)15-8-9-20(26)19(10-15)25(28)29/h3-11,16,24,26H,12-13H2,1-2H3 |
| InChIKey | MFSGRQYDALXYNP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|