C23H24N2O — CID 3353892
8,8-dimethyl-3,5-diphenyl-2,5,7,9-tetrahydro-1H-1,2-benzodiazepin-6-one (PubChem CID 3353892) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is 8,8-dimethyl-3,5-diphenyl-2,5,7,9-tetrahydro-1H-1,2-benzodiazepin-6-one.
| Compound Name | 8,8-dimethyl-3,5-diphenyl-2,5,7,9-tetrahydro-1H-1,2-benzodiazepin-6-one |
|---|---|
| PubChem CID | 3353892 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 8,8-dimethyl-3,5-diphenyl-2,5,7,9-tetrahydro-1H-1,2-benzodiazepin-6-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)NNC(c1ccccc1)=CC2c1ccccc1 |
| InChI | InChI=1S/C23H24N2O/c1-23(2)14-20-22(21(26)15-23)18(16-9-5-3-6-10-16)13-19(24-25-20)17-11-7-4-8-12-17/h3-13,18,24-25H,14-15H2,1-2H3 |
| InChIKey | KASVTRQJFGMETE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |